C19H13ClF3NO5 — CID 6237690
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide (PubChem CID 6237690) has the molecular formula C19H13ClF3NO5 and a molecular weight of 427.76 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 6237690 |
| Molecular Formula | C19H13ClF3NO5 |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)acetamide |
| SMILES | Cc1c(CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c(=O)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C19H13ClF3NO5/c1-8-10-3-5-14(25)16(27)17(10)29-18(28)11(8)7-15(26)24-9-2-4-13(20)12(6-9)19(21,22)23/h2-6,25,27H,7H2,1H3,(H,24,26) |
| InChIKey | OEZRMGWKJHNGIK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|