C16H18ClNO5S — CID 29105398
6-chloro-8-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one (PubChem CID 29105398) has the molecular formula C16H18ClNO5S and a molecular weight of 371.84 g/mol. Its IUPAC name is 6-chloro-8-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one.
| Compound Name | 6-chloro-8-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 29105398 |
| Molecular Formula | C16H18ClNO5S |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 6-chloro-8-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2cc(Cl)c(O)c(CN[C@H]3CCS(=O)(=O)C3)c2oc1=O |
| InChI | InChI=1S/C16H18ClNO5S/c1-8-9(2)16(20)23-15-11(8)5-13(17)14(19)12(15)6-18-10-3-4-24(21,22)7-10/h5,10,18-19H,3-4,6-7H2,1-2H3/t10-/m0/s1 |
| InChIKey | YMBBFAFDCPAKFF-JTQLQIEISA-N |
| XLogP | 2.05 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|