C15H23NO2S — CID 43614931
1,1-dioxo-N-[(2,4,6-trimethylphenyl)methyl]thian-4-amine (PubChem CID 43614931) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 1,1-dioxo-N-[(2,4,6-trimethylphenyl)methyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[(2,4,6-trimethylphenyl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 43614931 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1,1-dioxo-N-[(2,4,6-trimethylphenyl)methyl]thian-4-amine |
| SMILES | Cc1cc(C)c(CNC2CCS(=O)(=O)CC2)c(C)c1 |
| InChI | InChI=1S/C15H23NO2S/c1-11-8-12(2)15(13(3)9-11)10-16-14-4-6-19(17,18)7-5-14/h8-9,14,16H,4-7,10H2,1-3H3 |
| InChIKey | MQUBMOOJVRKDSY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |