About N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine (PubChem CID 43615022) has the molecular formula C12H19N3O4S
and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine |
| PubChem CID | 43615022 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine |
| SMILES | COc1ncnc(OC)c1CNC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H19N3O4S/c1-18-11-10(12(19-2)15-8-14-11)7-13-9-3-5-20(16,17)6-4-9/h8-9,13H,3-7H2,1-2H3 |
| InChIKey | OSZWIJVNFSERRG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine?
The IUPAC name of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine (CID 43615022) is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine.
What is the SMILES notation for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine?
The canonical SMILES for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine is COc1ncnc(OC)c1CNC1CCS(=O)(=O)CC1.
What is the InChIKey of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine?
The InChIKey is OSZWIJVNFSERRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4S/c1-18-11-10(12(19-2)15-8-14-11)7-13-9-3-5-20(16,17)6-4-9/h8-9,13H,3-7H2,1-2H3.
What are the key properties of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine?
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine has a molecular weight of 301.37 g/mol, XLogP of 0.16, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-1,1-dioxothian-4-amine is sourced from PubChem (CID 43615022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).