C13H18ClNO3S — CID 104815757
N-[(2-chloro-6-methoxyphenyl)methyl]-1,1-dioxothian-4-amine (PubChem CID 104815757) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyphenyl)methyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[(2-chloro-6-methoxyphenyl)methyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 104815757 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-[(2-chloro-6-methoxyphenyl)methyl]-1,1-dioxothian-4-amine |
| SMILES | COc1cccc(Cl)c1CNC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-18-13-4-2-3-12(14)11(13)9-15-10-5-7-19(16,17)8-6-10/h2-4,10,15H,5-9H2,1H3 |
| InChIKey | FNMRGYDIVXOLCA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |