C24H30Cl2N2O3 — CID 44668199
8-[[(1-benzylpiperidin-4-yl)amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one;dihydrochloride (PubChem CID 44668199) has the molecular formula C24H30Cl2N2O3 and a molecular weight of 465.42 g/mol. Its IUPAC name is 8-[[(1-benzylpiperidin-4-yl)amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one;dihydrochloride.
| Compound Name | 8-[[(1-benzylpiperidin-4-yl)amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one;dihydrochloride |
|---|---|
| PubChem CID | 44668199 |
| Molecular Formula | C24H30Cl2N2O3 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 8-[[(1-benzylpiperidin-4-yl)amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one;dihydrochloride |
| SMILES | Cc1c(C)c2ccc(O)c(CNC3CCN(Cc4ccccc4)CC3)c2oc1=O.Cl.Cl |
| InChI | InChI=1S/C24H28N2O3.2ClH/c1-16-17(2)24(28)29-23-20(16)8-9-22(27)21(23)14-25-19-10-12-26(13-11-19)15-18-6-4-3-5-7-18;;/h3-9,19,25,27H,10-15H2,1-2H3;2*1H |
| InChIKey | ZYMVSJKBSWWBAZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|