C25H29ClN2O4 — CID 44667308
1-[3-[(3-benzyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methylamino]propyl]pyrrolidin-2-one;hydrochloride (PubChem CID 44667308) has the molecular formula C25H29ClN2O4 and a molecular weight of 456.97 g/mol. Its IUPAC name is 1-[3-[(3-benzyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methylamino]propyl]pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-[3-[(3-benzyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methylamino]propyl]pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 44667308 |
| Molecular Formula | C25H29ClN2O4 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 1-[3-[(3-benzyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methylamino]propyl]pyrrolidin-2-one;hydrochloride |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c(CNCCCN3CCCC3=O)c(O)ccc12.Cl |
| InChI | InChI=1S/C25H28N2O4.ClH/c1-17-19-10-11-22(28)21(16-26-12-6-14-27-13-5-9-23(27)29)24(19)31-25(30)20(17)15-18-7-3-2-4-8-18;/h2-4,7-8,10-11,26,28H,5-6,9,12-16H2,1H3;1H |
| InChIKey | OPEJFMSDGLTVMV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|