C21H23Cl2NO4 — CID 45370546
3-benzyl-6-chloro-7-hydroxy-8-[(2-methoxyethylamino)methyl]-4-methylchromen-2-one;hydrochloride (PubChem CID 45370546) has the molecular formula C21H23Cl2NO4 and a molecular weight of 424.32 g/mol. Its IUPAC name is 3-benzyl-6-chloro-7-hydroxy-8-[(2-methoxyethylamino)methyl]-4-methylchromen-2-one;hydrochloride.
| Compound Name | 3-benzyl-6-chloro-7-hydroxy-8-[(2-methoxyethylamino)methyl]-4-methylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 45370546 |
| Molecular Formula | C21H23Cl2NO4 |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 3-benzyl-6-chloro-7-hydroxy-8-[(2-methoxyethylamino)methyl]-4-methylchromen-2-one;hydrochloride |
| SMILES | COCCNCc1c(O)c(Cl)cc2c(C)c(Cc3ccccc3)c(=O)oc12.Cl |
| InChI | InChI=1S/C21H22ClNO4.ClH/c1-13-15-11-18(22)19(24)17(12-23-8-9-26-2)20(15)27-21(25)16(13)10-14-6-4-3-5-7-14;/h3-7,11,23-24H,8-10,12H2,1-2H3;1H |
| InChIKey | PEVAARQPFLJSQF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|