C20H14O8 — CID 57388516
3-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-7,8-dihydroxy-4-methylchromen-2-one (PubChem CID 57388516) has the molecular formula C20H14O8 and a molecular weight of 382.32 g/mol. Its IUPAC name is 3-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-7,8-dihydroxy-4-methylchromen-2-one.
| Compound Name | 3-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-7,8-dihydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 57388516 |
| Molecular Formula | C20H14O8 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 3-(7,8-dihydroxy-4-methyl-2-oxochromen-3-yl)-7,8-dihydroxy-4-methylchromen-2-one |
| SMILES | Cc1c(-c2c(C)c3ccc(O)c(O)c3oc2=O)c(=O)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C20H14O8/c1-7-9-3-5-11(21)15(23)17(9)27-19(25)13(7)14-8(2)10-4-6-12(22)16(24)18(10)28-20(14)26/h3-6,21-24H,1-2H3 |
| InChIKey | IIGBIRZCEMSKHU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|