C11H11NO3 — CID 124706841
8-amino-7-hydroxy-3,4-dimethylchromen-2-one (PubChem CID 124706841) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 8-amino-7-hydroxy-3,4-dimethylchromen-2-one.
| Compound Name | 8-amino-7-hydroxy-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 124706841 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 8-amino-7-hydroxy-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(O)c(N)c2oc1=O |
| InChI | InChI=1S/C11H11NO3/c1-5-6(2)11(14)15-10-7(5)3-4-8(13)9(10)12/h3-4,13H,12H2,1-2H3 |
| InChIKey | BRBTYGCIOGIONN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|