C11H7BrO4 — CID 24799272
3-bromo-7-hydroxy-4-methyl-2-oxochromene-8-carbaldehyde (PubChem CID 24799272) has the molecular formula C11H7BrO4 and a molecular weight of 283.08 g/mol. Its IUPAC name is 3-bromo-7-hydroxy-4-methyl-2-oxochromene-8-carbaldehyde.
| Compound Name | 3-bromo-7-hydroxy-4-methyl-2-oxochromene-8-carbaldehyde |
|---|---|
| PubChem CID | 24799272 |
| Molecular Formula | C11H7BrO4 |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 3-bromo-7-hydroxy-4-methyl-2-oxochromene-8-carbaldehyde |
| SMILES | Cc1c(Br)c(=O)oc2c(C=O)c(O)ccc12 |
| InChI | InChI=1S/C11H7BrO4/c1-5-6-2-3-8(14)7(4-13)10(6)16-11(15)9(5)12/h2-4,14H,1H3 |
| InChIKey | YMUFHKSSNMFQIZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|