C20H18N2O6S — CID 159263884
7-hydroxy-4-methyl-3-[4-methyl-5-(morpholine-4-carbonyl)-1,3-thiazol-2-yl]-2-oxochromene-8-carbaldehyde (PubChem CID 159263884) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is 7-hydroxy-4-methyl-3-[4-methyl-5-(morpholine-4-carbonyl)-1,3-thiazol-2-yl]-2-oxochromene-8-carbaldehyde.
| Compound Name | 7-hydroxy-4-methyl-3-[4-methyl-5-(morpholine-4-carbonyl)-1,3-thiazol-2-yl]-2-oxochromene-8-carbaldehyde |
|---|---|
| PubChem CID | 159263884 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 7-hydroxy-4-methyl-3-[4-methyl-5-(morpholine-4-carbonyl)-1,3-thiazol-2-yl]-2-oxochromene-8-carbaldehyde |
| SMILES | Cc1nc(-c2c(C)c3ccc(O)c(C=O)c3oc2=O)sc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H18N2O6S/c1-10-12-3-4-14(24)13(9-23)16(12)28-20(26)15(10)18-21-11(2)17(29-18)19(25)22-5-7-27-8-6-22/h3-4,9,24H,5-8H2,1-2H3 |
| InChIKey | KWVVENLYZSAFNN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|