C18H10Br2O3 — CID 58008404
3,9-dibromo-4-methyl-8-phenylfuro[2,3-h]chromen-2-one (PubChem CID 58008404) has the molecular formula C18H10Br2O3 and a molecular weight of 434.08 g/mol. Its IUPAC name is 3,9-dibromo-4-methyl-8-phenylfuro[2,3-h]chromen-2-one.
| Compound Name | 3,9-dibromo-4-methyl-8-phenylfuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 58008404 |
| Molecular Formula | C18H10Br2O3 |
| Molecular Weight | 434.08 g/mol |
| Exact Mass | 431.90 |
| IUPAC Name | 3,9-dibromo-4-methyl-8-phenylfuro[2,3-h]chromen-2-one |
| SMILES | Cc1c(Br)c(=O)oc2c1ccc1oc(-c3ccccc3)c(Br)c12 |
| InChI | InChI=1S/C18H10Br2O3/c1-9-11-7-8-12-13(17(11)23-18(21)14(9)19)15(20)16(22-12)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | HZWQKNYGMWEWPO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.08 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|