C19H19ClNO3+ — CID 7204946
[3-(4-chlorophenyl)-7-hydroxy-4-methyl-2-oxochromen-8-yl]methyl-dimethylazanium (PubChem CID 7204946) has the molecular formula C19H19ClNO3+ and a molecular weight of 344.82 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-7-hydroxy-4-methyl-2-oxochromen-8-yl]methyl-dimethylazanium.
| Compound Name | [3-(4-chlorophenyl)-7-hydroxy-4-methyl-2-oxochromen-8-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 7204946 |
| Molecular Formula | C19H19ClNO3+ |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [3-(4-chlorophenyl)-7-hydroxy-4-methyl-2-oxochromen-8-yl]methyl-dimethylazanium |
| SMILES | Cc1c(-c2ccc(Cl)cc2)c(=O)oc2c(C[NH+](C)C)c(O)ccc12 |
| InChI | InChI=1S/C19H18ClNO3/c1-11-14-8-9-16(22)15(10-21(2)3)18(14)24-19(23)17(11)12-4-6-13(20)7-5-12/h4-9,22H,10H2,1-3H3/p+1 |
| InChIKey | ASHFBCZFYZJHDV-UHFFFAOYSA-O |
| XLogP | 2.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|