C21H24NO5+ — CID 7094603
[3-(2,5-dimethoxyphenyl)-7-hydroxy-4-methyl-2-oxochromen-8-yl]methyl-dimethylazanium (PubChem CID 7094603) has the molecular formula C21H24NO5+ and a molecular weight of 370.43 g/mol. Its IUPAC name is [3-(2,5-dimethoxyphenyl)-7-hydroxy-4-methyl-2-oxochromen-8-yl]methyl-dimethylazanium.
| Compound Name | [3-(2,5-dimethoxyphenyl)-7-hydroxy-4-methyl-2-oxochromen-8-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 7094603 |
| Molecular Formula | C21H24NO5+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [3-(2,5-dimethoxyphenyl)-7-hydroxy-4-methyl-2-oxochromen-8-yl]methyl-dimethylazanium |
| SMILES | COc1ccc(OC)c(-c2c(C)c3ccc(O)c(C[NH+](C)C)c3oc2=O)c1 |
| InChI | InChI=1S/C21H23NO5/c1-12-14-7-8-17(23)16(11-22(2)3)20(14)27-21(24)19(12)15-10-13(25-4)6-9-18(15)26-5/h6-10,23H,11H2,1-5H3/p+1 |
| InChIKey | ZMBLLHUNANYGNR-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|