C26H25NO6 — CID 158615585
3-(2,5-dimethoxyphenyl)-4-methylchromen-2-one;methyl(phenyl)carbamic acid (PubChem CID 158615585) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-4-methylchromen-2-one;methyl(phenyl)carbamic acid.
| Compound Name | 3-(2,5-dimethoxyphenyl)-4-methylchromen-2-one;methyl(phenyl)carbamic acid |
|---|---|
| PubChem CID | 158615585 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-4-methylchromen-2-one;methyl(phenyl)carbamic acid |
| SMILES | CN(C(=O)O)c1ccccc1.COc1ccc(OC)c(-c2c(C)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C18H16O4.C8H9NO2/c1-11-13-6-4-5-7-16(13)22-18(19)17(11)14-10-12(20-2)8-9-15(14)21-3;1-9(8(10)11)7-5-3-2-4-6-7/h4-10H,1-3H3;2-6H,1H3,(H,10,11) |
| InChIKey | HXIRIKIRFFDFGB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|