C19H15NO4 — CID 118156079
4-(2,5-dimethoxyphenyl)-1H-[1]benzofuro[3,2-b]pyridin-2-one (PubChem CID 118156079) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-1H-[1]benzofuro[3,2-b]pyridin-2-one.
| Compound Name | 4-(2,5-dimethoxyphenyl)-1H-[1]benzofuro[3,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 118156079 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-1H-[1]benzofuro[3,2-b]pyridin-2-one |
| SMILES | COc1ccc(OC)c(-c2cc(=O)[nH]c3c2oc2ccccc23)c1 |
| InChI | InChI=1S/C19H15NO4/c1-22-11-7-8-15(23-2)13(9-11)14-10-17(21)20-18-12-5-3-4-6-16(12)24-19(14)18/h3-10H,1-2H3,(H,20,21) |
| InChIKey | NYQXEWOUHABABL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |