C19H16FNO2 — CID 144861965
ethane;4-(2-fluorophenyl)-1H-[1]benzofuro[3,2-b]pyridin-2-one (PubChem CID 144861965) has the molecular formula C19H16FNO2 and a molecular weight of 309.34 g/mol. Its IUPAC name is ethane;4-(2-fluorophenyl)-1H-[1]benzofuro[3,2-b]pyridin-2-one.
| Compound Name | ethane;4-(2-fluorophenyl)-1H-[1]benzofuro[3,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 144861965 |
| Molecular Formula | C19H16FNO2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | ethane;4-(2-fluorophenyl)-1H-[1]benzofuro[3,2-b]pyridin-2-one |
| SMILES | CC.O=c1cc(-c2ccccc2F)c2oc3ccccc3c2[nH]1 |
| InChI | InChI=1S/C17H10FNO2.C2H6/c18-13-7-3-1-5-10(13)12-9-15(20)19-16-11-6-2-4-8-14(11)21-17(12)16;1-2/h1-9H,(H,19,20);1-2H3 |
| InChIKey | ICTQXWCEKZDFSS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |