C14H11NO4 — CID 10777524
ethyl 4-oxo-1H-[1]benzofuro[3,2-b]pyridine-2-carboxylate (PubChem CID 10777524) has the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. Its IUPAC name is ethyl 4-oxo-1H-[1]benzofuro[3,2-b]pyridine-2-carboxylate.
| Compound Name | ethyl 4-oxo-1H-[1]benzofuro[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 10777524 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | ethyl 4-oxo-1H-[1]benzofuro[3,2-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2oc3ccccc3c2[nH]1 |
| InChI | InChI=1S/C14H11NO4/c1-2-18-14(17)9-7-10(16)13-12(15-9)8-5-3-4-6-11(8)19-13/h3-7H,2H2,1H3,(H,15,16) |
| InChIKey | NSIOYWHJXRNEST-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |