C9H8BrNO3 — CID 59648581
ethyl 3-bromo-4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 59648581) has the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. Its IUPAC name is ethyl 3-bromo-4H-furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 3-bromo-4H-furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 59648581 |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | ethyl 3-bromo-4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2occ(Br)c2[nH]1 |
| InChI | InChI=1S/C9H8BrNO3/c1-2-13-9(12)6-3-7-8(11-6)5(10)4-14-7/h3-4,11H,2H2,1H3 |
| InChIKey | BRCYQLJSKNOAFL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |