C14H14N2O4S — CID 11558576
diethyl 7-thia-3,11-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-dicarboxylate (PubChem CID 11558576) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is diethyl 7-thia-3,11-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-dicarboxylate.
| Compound Name | diethyl 7-thia-3,11-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-dicarboxylate |
|---|---|
| PubChem CID | 11558576 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | diethyl 7-thia-3,11-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4,10-dicarboxylate |
| SMILES | CCOC(=O)c1cc2sc3cc(C(=O)OCC)[nH]c3c2[nH]1 |
| InChI | InChI=1S/C14H14N2O4S/c1-3-19-13(17)7-5-9-11(15-7)12-10(21-9)6-8(16-12)14(18)20-4-2/h5-6,15-16H,3-4H2,1-2H3 |
| InChIKey | DCAJLFPAZNLFMZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |