C24H17FO4 — CID 158363428
dibenzofuran-1-ol;2-(2-fluorophenyl)benzene-1,3-diol (PubChem CID 158363428) has the molecular formula C24H17FO4 and a molecular weight of 388.39 g/mol. Its IUPAC name is dibenzofuran-1-ol;2-(2-fluorophenyl)benzene-1,3-diol.
| Compound Name | dibenzofuran-1-ol;2-(2-fluorophenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 158363428 |
| Molecular Formula | C24H17FO4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | dibenzofuran-1-ol;2-(2-fluorophenyl)benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1-c1ccccc1F.Oc1cccc2oc3ccccc3c12 |
| InChI | InChI=1S/C12H9FO2.C12H8O2/c13-9-5-2-1-4-8(9)12-10(14)6-3-7-11(12)15;13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h1-7,14-15H;1-7,13H |
| InChIKey | GTSXXTUBSGLKOY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |