C21H10Cl2FN3O — CID 171578577
2,4-dichloro-6-(2-dibenzofuran-1-yl-6-fluorophenyl)-1,3,5-triazine (PubChem CID 171578577) has the molecular formula C21H10Cl2FN3O and a molecular weight of 410.24 g/mol. Its IUPAC name is 2,4-dichloro-6-(2-dibenzofuran-1-yl-6-fluorophenyl)-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-(2-dibenzofuran-1-yl-6-fluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171578577 |
| Molecular Formula | C21H10Cl2FN3O |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 2,4-dichloro-6-(2-dibenzofuran-1-yl-6-fluorophenyl)-1,3,5-triazine |
| SMILES | Fc1cccc(-c2cccc3oc4ccccc4c23)c1-c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C21H10Cl2FN3O/c22-20-25-19(26-21(23)27-20)18-12(6-3-8-14(18)24)11-7-4-10-16-17(11)13-5-1-2-9-15(13)28-16/h1-10H |
| InChIKey | DWKOLRBFXHGYPN-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |