C17H13NO3 — CID 118101187
8-methoxy-3-methyl-5H-[1]benzofuro[3,2-b]quinolin-11-one (PubChem CID 118101187) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 8-methoxy-3-methyl-5H-[1]benzofuro[3,2-b]quinolin-11-one.
| Compound Name | 8-methoxy-3-methyl-5H-[1]benzofuro[3,2-b]quinolin-11-one |
|---|---|
| PubChem CID | 118101187 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 8-methoxy-3-methyl-5H-[1]benzofuro[3,2-b]quinolin-11-one |
| SMILES | COc1ccc2c(c1)oc1c(=O)c3ccc(C)cc3[nH]c12 |
| InChI | InChI=1S/C17H13NO3/c1-9-3-5-11-13(7-9)18-15-12-6-4-10(20-2)8-14(12)21-17(15)16(11)19/h3-8H,1-2H3,(H,18,19) |
| InChIKey | WICQHISLMJDGDJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |