C17H11BrO5 — CID 11440255
9-bromo-3,7-dimethoxy-[1]benzofuro[3,2-b]chromen-11-one (PubChem CID 11440255) has the molecular formula C17H11BrO5 and a molecular weight of 375.17 g/mol. Its IUPAC name is 9-bromo-3,7-dimethoxy-[1]benzofuro[3,2-b]chromen-11-one.
| Compound Name | 9-bromo-3,7-dimethoxy-[1]benzofuro[3,2-b]chromen-11-one |
|---|---|
| PubChem CID | 11440255 |
| Molecular Formula | C17H11BrO5 |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 9-bromo-3,7-dimethoxy-[1]benzofuro[3,2-b]chromen-11-one |
| SMILES | COc1ccc2c(=O)c3oc4c(Br)cc(OC)cc4c3oc2c1 |
| InChI | InChI=1S/C17H11BrO5/c1-20-8-3-4-10-13(7-8)22-16-11-5-9(21-2)6-12(18)15(11)23-17(16)14(10)19/h3-7H,1-2H3 |
| InChIKey | SMDPLZRJABPNIL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |