C18H13NO4 — CID 71518904
methyl 9-methyl-2-oxo-11H-pyrano[2,3-a]carbazole-4-carboxylate (PubChem CID 71518904) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is methyl 9-methyl-2-oxo-11H-pyrano[2,3-a]carbazole-4-carboxylate.
| Compound Name | methyl 9-methyl-2-oxo-11H-pyrano[2,3-a]carbazole-4-carboxylate |
|---|---|
| PubChem CID | 71518904 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | methyl 9-methyl-2-oxo-11H-pyrano[2,3-a]carbazole-4-carboxylate |
| SMILES | COC(=O)c1cc(=O)oc2c1ccc1c3ccc(C)cc3[nH]c12 |
| InChI | InChI=1S/C18H13NO4/c1-9-3-4-10-11-5-6-12-13(18(21)22-2)8-15(20)23-17(12)16(11)19-14(10)7-9/h3-8,19H,1-2H3 |
| InChIKey | SMMNNULKXPVXBW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|