C13H15NO2 — CID 54107367
methyl 2-(2,6-dimethyl-1H-indol-3-yl)acetate (PubChem CID 54107367) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is methyl 2-(2,6-dimethyl-1H-indol-3-yl)acetate.
| Compound Name | methyl 2-(2,6-dimethyl-1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 54107367 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | methyl 2-(2,6-dimethyl-1H-indol-3-yl)acetate |
| SMILES | COC(=O)Cc1c(C)[nH]c2cc(C)ccc12 |
| InChI | InChI=1S/C13H15NO2/c1-8-4-5-10-11(7-13(15)16-3)9(2)14-12(10)6-8/h4-6,14H,7H2,1-3H3 |
| InChIKey | NESBKPVYYNMZGX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|