C21H22N2O5 — CID 10271239
2-[[2-(5,6-dimethoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-4-methylbenzoic acid (PubChem CID 10271239) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-[[2-(5,6-dimethoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-4-methylbenzoic acid.
| Compound Name | 2-[[2-(5,6-dimethoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 10271239 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-[[2-(5,6-dimethoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-4-methylbenzoic acid |
| SMILES | COc1cc2[nH]c(C)c(CC(=O)Nc3cc(C)ccc3C(=O)O)c2cc1OC |
| InChI | InChI=1S/C21H22N2O5/c1-11-5-6-13(21(25)26)16(7-11)23-20(24)9-14-12(2)22-17-10-19(28-4)18(27-3)8-15(14)17/h5-8,10,22H,9H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | FIYIJHDRTWPPQL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|