About methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate
methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate (PubChem CID 91226592) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate |
| PubChem CID | 91226592 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate |
| SMILES | CCOc1cc2c(CC(=O)OC)c(C)[nH]c2cc1C |
| InChI | InChI=1S/C15H19NO3/c1-5-19-14-7-12-11(8-15(17)18-4)10(3)16-13(12)6-9(14)2/h6-7,16H,5,8H2,1-4H3 |
| InChIKey | IXTLUIKKMSOGQK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate?
The IUPAC name of methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate (CID 91226592) is methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate.
What is the SMILES notation for methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate?
The canonical SMILES for methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate is CCOc1cc2c(CC(=O)OC)c(C)[nH]c2cc1C.
What is the InChIKey of methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate?
The InChIKey is IXTLUIKKMSOGQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-5-19-14-7-12-11(8-15(17)18-4)10(3)16-13(12)6-9(14)2/h6-7,16H,5,8H2,1-4H3.
What are the key properties of methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate?
methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate has a molecular weight of 261.32 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-ethoxy-2,6-dimethyl-1H-indol-3-yl)acetate is sourced from PubChem (CID 91226592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).