C11H12ClN — CID 130049399
3-(chloromethyl)-2,6-dimethyl-1H-indole (PubChem CID 130049399) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 3-(chloromethyl)-2,6-dimethyl-1H-indole.
| Compound Name | 3-(chloromethyl)-2,6-dimethyl-1H-indole |
|---|---|
| PubChem CID | 130049399 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-(chloromethyl)-2,6-dimethyl-1H-indole |
| SMILES | Cc1ccc2c(CCl)c(C)[nH]c2c1 |
| InChI | InChI=1S/C11H12ClN/c1-7-3-4-9-10(6-12)8(2)13-11(9)5-7/h3-5,13H,6H2,1-2H3 |
| InChIKey | LXBAMEOHRNTKKX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|