C15H10ClNO2 — CID 166048938
1-chloro-4-methoxy-10H-[1]benzofuro[3,2-b]indole (PubChem CID 166048938) has the molecular formula C15H10ClNO2 and a molecular weight of 271.70 g/mol. Its IUPAC name is 1-chloro-4-methoxy-10H-[1]benzofuro[3,2-b]indole.
| Compound Name | 1-chloro-4-methoxy-10H-[1]benzofuro[3,2-b]indole |
|---|---|
| PubChem CID | 166048938 |
| Molecular Formula | C15H10ClNO2 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 1-chloro-4-methoxy-10H-[1]benzofuro[3,2-b]indole |
| SMILES | COc1ccc(Cl)c2[nH]c3c4ccccc4oc3c12 |
| InChI | InChI=1S/C15H10ClNO2/c1-18-11-7-6-9(16)14-12(11)15-13(17-14)8-4-2-3-5-10(8)19-15/h2-7,17H,1H3 |
| InChIKey | YWVGALRTGZSGHN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |