C18H16ClNO — CID 167209754
6-chloro-9-methoxy-10,10-dimethyl-5H-indeno[1,2-b]indole (PubChem CID 167209754) has the molecular formula C18H16ClNO and a molecular weight of 297.79 g/mol. Its IUPAC name is 6-chloro-9-methoxy-10,10-dimethyl-5H-indeno[1,2-b]indole.
| Compound Name | 6-chloro-9-methoxy-10,10-dimethyl-5H-indeno[1,2-b]indole |
|---|---|
| PubChem CID | 167209754 |
| Molecular Formula | C18H16ClNO |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 6-chloro-9-methoxy-10,10-dimethyl-5H-indeno[1,2-b]indole |
| SMILES | COc1ccc(Cl)c2[nH]c3c(c12)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C18H16ClNO/c1-18(2)11-7-5-4-6-10(11)16-15(18)14-13(21-3)9-8-12(19)17(14)20-16/h4-9,20H,1-3H3 |
| InChIKey | BDZTYFHQYLIKCD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |