About 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione
1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione (PubChem CID 118713421) has the molecular formula C18H13NO4
and a molecular weight of 307.31 g/mol. Its IUPAC name is 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione.
Molecular Properties
| Compound Name | 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione |
| PubChem CID | 118713421 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione |
| SMILES | COc1ccc(OC)c2c3c([nH]c12)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C18H13NO4/c1-22-11-7-8-12(23-2)15-13(11)14-16(19-15)18(21)10-6-4-3-5-9(10)17(14)20/h3-8,19H,1-2H3 |
| InChIKey | NBMNTHREBNVTME-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione?
The IUPAC name of 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione (CID 118713421) is 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione.
What is the SMILES notation for 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione?
The canonical SMILES for 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione is COc1ccc(OC)c2c3c([nH]c12)C(=O)c1ccccc1C3=O.
What is the InChIKey of 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione?
The InChIKey is NBMNTHREBNVTME-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO4/c1-22-11-7-8-12(23-2)15-13(11)14-16(19-15)18(21)10-6-4-3-5-9(10)17(14)20/h3-8,19H,1-2H3.
What are the key properties of 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione?
1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione has a molecular weight of 307.31 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethoxy-5H-benzo[b]carbazole-6,11-dione is sourced from PubChem (CID 118713421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).