C12H6N2O4 — CID 121014847
1,4-dihydrobenzo[g]quinoxaline-2,3,5,10-tetrone (PubChem CID 121014847) has the molecular formula C12H6N2O4 and a molecular weight of 242.19 g/mol. Its IUPAC name is 1,4-dihydrobenzo[g]quinoxaline-2,3,5,10-tetrone.
| Compound Name | 1,4-dihydrobenzo[g]quinoxaline-2,3,5,10-tetrone |
|---|---|
| PubChem CID | 121014847 |
| Molecular Formula | C12H6N2O4 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1,4-dihydrobenzo[g]quinoxaline-2,3,5,10-tetrone |
| SMILES | O=C1c2ccccc2C(=O)c2[nH]c(=O)c(=O)[nH]c21 |
| InChI | InChI=1S/C12H6N2O4/c15-9-5-3-1-2-4-6(5)10(16)8-7(9)13-11(17)12(18)14-8/h1-4H,(H,13,17)(H,14,18) |
| InChIKey | ZQWLVEQIVHFZOP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|