C18H10N2O3 — CID 927711
3-phenyl-1H-benzo[g]quinoxaline-2,5,10-trione (PubChem CID 927711) has the molecular formula C18H10N2O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 3-phenyl-1H-benzo[g]quinoxaline-2,5,10-trione.
| Compound Name | 3-phenyl-1H-benzo[g]quinoxaline-2,5,10-trione |
|---|---|
| PubChem CID | 927711 |
| Molecular Formula | C18H10N2O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-phenyl-1H-benzo[g]quinoxaline-2,5,10-trione |
| SMILES | O=C1c2ccccc2C(=O)c2[nH]c(=O)c(-c3ccccc3)nc21 |
| InChI | InChI=1S/C18H10N2O3/c21-16-11-8-4-5-9-12(11)17(22)15-14(16)19-13(18(23)20-15)10-6-2-1-3-7-10/h1-9H,(H,20,23) |
| InChIKey | JGIYRACXBRPHAP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|