C12H6N2O2S2 — CID 15817926
2,3-bis(sulfanylidene)-1,4-dihydrobenzo[g]quinoxaline-5,10-dione (PubChem CID 15817926) has the molecular formula C12H6N2O2S2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 2,3-bis(sulfanylidene)-1,4-dihydrobenzo[g]quinoxaline-5,10-dione.
| Compound Name | 2,3-bis(sulfanylidene)-1,4-dihydrobenzo[g]quinoxaline-5,10-dione |
|---|---|
| PubChem CID | 15817926 |
| Molecular Formula | C12H6N2O2S2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 2,3-bis(sulfanylidene)-1,4-dihydrobenzo[g]quinoxaline-5,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2[nH]c(=S)c(=S)[nH]c21 |
| InChI | InChI=1S/C12H6N2O2S2/c15-9-5-3-1-2-4-6(5)10(16)8-7(9)13-11(17)12(18)14-8/h1-4H,(H,13,17)(H,14,18) |
| InChIKey | VWGZLWBDYSLXPP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|