C22H10N2O6 — CID 4528472
3,6-bis(1,3-dioxoinden-2-ylidene)piperazine-2,5-dione (PubChem CID 4528472) has the molecular formula C22H10N2O6 and a molecular weight of 398.33 g/mol. Its IUPAC name is 3,6-bis(1,3-dioxoinden-2-ylidene)piperazine-2,5-dione.
| Compound Name | 3,6-bis(1,3-dioxoinden-2-ylidene)piperazine-2,5-dione |
|---|---|
| PubChem CID | 4528472 |
| Molecular Formula | C22H10N2O6 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 3,6-bis(1,3-dioxoinden-2-ylidene)piperazine-2,5-dione |
| SMILES | O=C1C(=c2[nH]c(=O)c(=C3C(=O)c4ccccc4C3=O)[nH]c2=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H10N2O6/c25-17-9-5-1-2-6-10(9)18(26)13(17)15-21(29)24-16(22(30)23-15)14-19(27)11-7-3-4-8-12(11)20(14)28/h1-8H,(H,23,30)(H,24,29) |
| InChIKey | CFRDBKAHUYHCLN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'} |
|---|