C12H7NO2 — CID 45098873
1H-indeno[1,2-b]pyridine-2,5-dione (PubChem CID 45098873) has the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. Its IUPAC name is 1H-indeno[1,2-b]pyridine-2,5-dione.
| Compound Name | 1H-indeno[1,2-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 45098873 |
| Molecular Formula | C12H7NO2 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 1H-indeno[1,2-b]pyridine-2,5-dione |
| SMILES | O=C1c2ccccc2-c2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C12H7NO2/c14-10-6-5-9-11(13-10)7-3-1-2-4-8(7)12(9)15/h1-6H,(H,13,14) |
| InChIKey | WZMBZJVPPGWAPI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|