C17H18O2 — CID 134997139
2,3-dimethoxy-9,9-dimethylfluorene (PubChem CID 134997139) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2,3-dimethoxy-9,9-dimethylfluorene.
| Compound Name | 2,3-dimethoxy-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 134997139 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2,3-dimethoxy-9,9-dimethylfluorene |
| SMILES | COc1cc2c(cc1OC)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C17H18O2/c1-17(2)13-8-6-5-7-11(13)12-9-15(18-3)16(19-4)10-14(12)17/h5-10H,1-4H3 |
| InChIKey | NOVYXMLWGMACEM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |