C20H13Cl2NO3 — CID 123279844
3,5-dichloro-4-[2-(4-methoxydibenzofuran-1-yl)ethenyl]-1-oxidopyridin-1-ium (PubChem CID 123279844) has the molecular formula C20H13Cl2NO3 and a molecular weight of 386.23 g/mol. Its IUPAC name is 3,5-dichloro-4-[2-(4-methoxydibenzofuran-1-yl)ethenyl]-1-oxidopyridin-1-ium.
| Compound Name | 3,5-dichloro-4-[2-(4-methoxydibenzofuran-1-yl)ethenyl]-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 123279844 |
| Molecular Formula | C20H13Cl2NO3 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 3,5-dichloro-4-[2-(4-methoxydibenzofuran-1-yl)ethenyl]-1-oxidopyridin-1-ium |
| SMILES | COc1ccc(C=Cc2c(Cl)c[n+]([O-])cc2Cl)c2c1oc1ccccc12 |
| InChI | InChI=1S/C20H13Cl2NO3/c1-25-18-9-7-12(6-8-13-15(21)10-23(24)11-16(13)22)19-14-4-2-3-5-17(14)26-20(18)19/h2-11H,1H3 |
| InChIKey | SMFMBVUQVAYLTM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 49.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|