About methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine
methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine (PubChem CID 143172875) has the molecular formula C15H14N2O2S
and a molecular weight of 286.36 g/mol. Its IUPAC name is methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine.
Molecular Properties
| Compound Name | methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine |
| PubChem CID | 143172875 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine |
| SMILES | NC=S.[H]/N=C/c1ccc(OC)c2oc3ccccc3c12 |
| InChI | InChI=1S/C14H11NO2.CH3NS/c1-16-12-7-6-9(8-15)13-10-4-2-3-5-11(10)17-14(12)13;2-1-3/h2-8,15H,1H3;1H,(H2,2,3)/b15-8+; |
| InChIKey | SQVDMMYOPKVMQY-TWNLEINFSA-N |
| XLogP | 3.49 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine?
The IUPAC name of methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine (CID 143172875) is methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine.
What is the SMILES notation for methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine?
The canonical SMILES for methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine is NC=S.[H]/N=C/c1ccc(OC)c2oc3ccccc3c12.
What is the InChIKey of methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine?
The InChIKey is SQVDMMYOPKVMQY-TWNLEINFSA-N. The full InChI is InChI=1S/C14H11NO2.CH3NS/c1-16-12-7-6-9(8-15)13-10-4-2-3-5-11(10)17-14(12)13;2-1-3/h2-8,15H,1H3;1H,(H2,2,3)/b15-8+;.
What are the key properties of methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine?
methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine has a molecular weight of 286.36 g/mol, XLogP of 3.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanethioamide;(4-methoxydibenzofuran-1-yl)methanimine is sourced from PubChem (CID 143172875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).