C15H14O3 — CID 86106843
1,3-dimethoxy-4-methyldibenzofuran (PubChem CID 86106843) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1,3-dimethoxy-4-methyldibenzofuran.
| Compound Name | 1,3-dimethoxy-4-methyldibenzofuran |
|---|---|
| PubChem CID | 86106843 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1,3-dimethoxy-4-methyldibenzofuran |
| SMILES | COc1cc(OC)c2c(oc3ccccc32)c1C |
| InChI | InChI=1S/C15H14O3/c1-9-12(16-2)8-13(17-3)14-10-6-4-5-7-11(10)18-15(9)14/h4-8H,1-3H3 |
| InChIKey | BVLPCUGLRZFMCA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |