C15H11NO4 — CID 135763141
2-(2-hydroxy-5-methoxyphenyl)-1,3-benzoxazin-4-one (PubChem CID 135763141) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-(2-hydroxy-5-methoxyphenyl)-1,3-benzoxazin-4-one.
| Compound Name | 2-(2-hydroxy-5-methoxyphenyl)-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 135763141 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-(2-hydroxy-5-methoxyphenyl)-1,3-benzoxazin-4-one |
| SMILES | COc1ccc(O)c(-c2nc(=O)c3ccccc3o2)c1 |
| InChI | InChI=1S/C15H11NO4/c1-19-9-6-7-12(17)11(8-9)15-16-14(18)10-4-2-3-5-13(10)20-15/h2-8,17H,1H3 |
| InChIKey | SXOWHCVJPMQWFR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |