C16H8N2O4 — CID 68786236
5-(4-oxo-1,3-benzoxazin-2-yl)isoindole-1,3-dione (PubChem CID 68786236) has the molecular formula C16H8N2O4 and a molecular weight of 292.25 g/mol. Its IUPAC name is 5-(4-oxo-1,3-benzoxazin-2-yl)isoindole-1,3-dione.
| Compound Name | 5-(4-oxo-1,3-benzoxazin-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 68786236 |
| Molecular Formula | C16H8N2O4 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 5-(4-oxo-1,3-benzoxazin-2-yl)isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(-c3nc(=O)c4ccccc4o3)ccc21 |
| InChI | InChI=1S/C16H8N2O4/c19-13-9-6-5-8(7-11(9)15(21)17-13)16-18-14(20)10-3-1-2-4-12(10)22-16/h1-7H,(H,17,19,21) |
| InChIKey | IZFSGKOJIRNNIK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|