C24H18N2O3 — CID 11639542
(3E)-6-(1,3-benzoxazol-2-yl)-3-[(2-ethoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 11639542) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is (3E)-6-(1,3-benzoxazol-2-yl)-3-[(2-ethoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-(1,3-benzoxazol-2-yl)-3-[(2-ethoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 11639542 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (3E)-6-(1,3-benzoxazol-2-yl)-3-[(2-ethoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | CCOc1ccccc1/C=C1/C(=O)Nc2cc(-c3nc4ccccc4o3)ccc21 |
| InChI | InChI=1S/C24H18N2O3/c1-2-28-21-9-5-3-7-15(21)13-18-17-12-11-16(14-20(17)25-23(18)27)24-26-19-8-4-6-10-22(19)29-24/h3-14H,2H2,1H3,(H,25,27)/b18-13+ |
| InChIKey | CKURLYUXFOOXPT-QGOAFFKASA-N |
| XLogP | 5.39 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|