C31H19N3O3 — CID 76839926
3-[[4-[5-[(2-oxo-1H-indol-3-ylidene)methyl]-1,3-benzoxazol-2-yl]phenyl]methylidene]-1H-indol-2-one (PubChem CID 76839926) has the molecular formula C31H19N3O3 and a molecular weight of 481.51 g/mol. Its IUPAC name is 3-[[4-[5-[(2-oxo-1H-indol-3-ylidene)methyl]-1,3-benzoxazol-2-yl]phenyl]methylidene]-1H-indol-2-one.
| Compound Name | 3-[[4-[5-[(2-oxo-1H-indol-3-ylidene)methyl]-1,3-benzoxazol-2-yl]phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 76839926 |
| Molecular Formula | C31H19N3O3 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 3-[[4-[5-[(2-oxo-1H-indol-3-ylidene)methyl]-1,3-benzoxazol-2-yl]phenyl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2C1=Cc1ccc(-c2nc3cc(C=C4C(=O)Nc5ccccc54)ccc3o2)cc1 |
| InChI | InChI=1S/C31H19N3O3/c35-29-23(21-5-1-3-7-25(21)32-29)15-18-9-12-20(13-10-18)31-34-27-17-19(11-14-28(27)37-31)16-24-22-6-2-4-8-26(22)33-30(24)36/h1-17H,(H,32,35)(H,33,36) |
| InChIKey | TXMFUAVNCRXUKV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|