C16H10N2O2 — CID 78015919
3-(1,3-benzoxazol-2-ylmethylidene)-1H-indol-2-one (PubChem CID 78015919) has the molecular formula C16H10N2O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylmethylidene)-1H-indol-2-one.
| Compound Name | 3-(1,3-benzoxazol-2-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 78015919 |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2C1=Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H10N2O2/c19-16-11(10-5-1-2-6-12(10)18-16)9-15-17-13-7-3-4-8-14(13)20-15/h1-9H,(H,18,19) |
| InChIKey | HYPLRIRPOXFGDB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|