C23H18N2O4 — CID 58662750
(3E)-3-[(2-ethoxyphenyl)methylidene]-6-(3-nitrophenyl)-1H-indol-2-one (PubChem CID 58662750) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is (3E)-3-[(2-ethoxyphenyl)methylidene]-6-(3-nitrophenyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[(2-ethoxyphenyl)methylidene]-6-(3-nitrophenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 58662750 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (3E)-3-[(2-ethoxyphenyl)methylidene]-6-(3-nitrophenyl)-1H-indol-2-one |
| SMILES | CCOc1ccccc1/C=C1/C(=O)Nc2cc(-c3cccc([N+](=O)[O-])c3)ccc21 |
| InChI | InChI=1S/C23H18N2O4/c1-2-29-22-9-4-3-6-17(22)13-20-19-11-10-16(14-21(19)24-23(20)26)15-7-5-8-18(12-15)25(27)28/h3-14H,2H2,1H3,(H,24,26)/b20-13+ |
| InChIKey | KOOMIFRLQUQPJT-DEDYPNTBSA-N |
| XLogP | 5.15 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|