C19H10N2O3 — CID 155420196
6-(1,3-benzoxazol-2-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 155420196) has the molecular formula C19H10N2O3 and a molecular weight of 314.30 g/mol. Its IUPAC name is 6-(1,3-benzoxazol-2-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(1,3-benzoxazol-2-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 155420196 |
| Molecular Formula | C19H10N2O3 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 6-(1,3-benzoxazol-2-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1NC(=O)c2ccc(-c3nc4ccccc4o3)c3cccc1c23 |
| InChI | InChI=1S/C19H10N2O3/c22-17-12-5-3-4-10-11(8-9-13(16(10)12)18(23)21-17)19-20-14-6-1-2-7-15(14)24-19/h1-9H,(H,21,22,23) |
| InChIKey | PLSJXMLBDMSTMP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|