C12H8N2O2 — CID 140696136
3-(1,3-benzoxazol-2-yl)-1H-pyridin-4-one (PubChem CID 140696136) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-1H-pyridin-4-one.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 140696136 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-1H-pyridin-4-one |
| SMILES | O=c1cc[nH]cc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C12H8N2O2/c15-10-5-6-13-7-8(10)12-14-9-3-1-2-4-11(9)16-12/h1-7H,(H,13,15) |
| InChIKey | YJRNXOIIGPZKSQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |